C29H38N2O6 — CID 57045100
diethyl 4-[2-(3-cyclohexyloxy-3-oxoprop-1-enyl)phenyl]-6-methyl-2-(methyliminomethyl)-2,3,4,5-tetrahydropyridine-3,5-dicarboxylate (PubChem CID 57045100) has the molecular formula C29H38N2O6 and a molecular weight of 510.63 g/mol. Its IUPAC name is diethyl 4-[2-(3-cyclohexyloxy-3-oxoprop-1-enyl)phenyl]-6-methyl-2-(methyliminomethyl)-2,3,4,5-tetrahydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 4-[2-(3-cyclohexyloxy-3-oxoprop-1-enyl)phenyl]-6-methyl-2-(methyliminomethyl)-2,3,4,5-tetrahydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 57045100 |
| Molecular Formula | C29H38N2O6 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | diethyl 4-[2-(3-cyclohexyloxy-3-oxoprop-1-enyl)phenyl]-6-methyl-2-(methyliminomethyl)-2,3,4,5-tetrahydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1C(C)=NC(/C=N/C)C(C(=O)OCC)C1c1ccccc1C=CC(=O)OC1CCCCC1 |
| InChI | InChI=1S/C29H38N2O6/c1-5-35-28(33)25-19(3)31-23(18-30-4)27(29(34)36-6-2)26(25)22-15-11-10-12-20(22)16-17-24(32)37-21-13-8-7-9-14-21/h10-12,15-18,21,23,25-27H,5-9,13-14H2,1-4H3/b17-16?,30-18+ |
| InChIKey | DTYKDVHDSXEIFW-FZBKVLIQSA-N |
| XLogP | 4.56 |
| TPSA | 103.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|