C12H12Br4O2 — CID 57045238
3-ethyl-3-[(2,3,4,5-tetrabromophenoxy)methyl]oxetane (PubChem CID 57045238) has the molecular formula C12H12Br4O2 and a molecular weight of 507.84 g/mol. Its IUPAC name is 3-ethyl-3-[(2,3,4,5-tetrabromophenoxy)methyl]oxetane.
| Compound Name | 3-ethyl-3-[(2,3,4,5-tetrabromophenoxy)methyl]oxetane |
|---|---|
| PubChem CID | 57045238 |
| Molecular Formula | C12H12Br4O2 |
| Molecular Weight | 507.84 g/mol |
| Exact Mass | 503.76 |
| IUPAC Name | 3-ethyl-3-[(2,3,4,5-tetrabromophenoxy)methyl]oxetane |
| SMILES | CCC1(COc2cc(Br)c(Br)c(Br)c2Br)COC1 |
| InChI | InChI=1S/C12H12Br4O2/c1-2-12(4-17-5-12)6-18-8-3-7(13)9(14)11(16)10(8)15/h3H,2,4-6H2,1H3 |
| InChIKey | REYCDJWAYCZBMX-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.84 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|