C17H28N2O4 — CID 57045419
(2R)-6-amino-2-(but-2-enoylamino)-2-(cyclohexanecarbonyl)hexanoic acid (PubChem CID 57045419) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is (2R)-6-amino-2-(but-2-enoylamino)-2-(cyclohexanecarbonyl)hexanoic acid.
| Compound Name | (2R)-6-amino-2-(but-2-enoylamino)-2-(cyclohexanecarbonyl)hexanoic acid |
|---|---|
| PubChem CID | 57045419 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | (2R)-6-amino-2-(but-2-enoylamino)-2-(cyclohexanecarbonyl)hexanoic acid |
| SMILES | CC=CC(=O)N[C@@](CCCCN)(C(=O)O)C(=O)C1CCCCC1 |
| InChI | InChI=1S/C17H28N2O4/c1-2-8-14(20)19-17(16(22)23,11-6-7-12-18)15(21)13-9-4-3-5-10-13/h2,8,13H,3-7,9-12,18H2,1H3,(H,19,20)(H,22,23)/t17-/m1/s1 |
| InChIKey | TVKWCZAUQYTSQJ-QGZVFWFLSA-N |
| XLogP | 1.78 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|