C11H19N — CID 57045996
1,2,3,4,5,6-hexamethyl-2H-pyridine (PubChem CID 57045996) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexamethyl-2H-pyridine.
| Compound Name | 1,2,3,4,5,6-hexamethyl-2H-pyridine |
|---|---|
| PubChem CID | 57045996 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 1,2,3,4,5,6-hexamethyl-2H-pyridine |
| SMILES | CC1=C(C)C(C)N(C)C(C)=C1C |
| InChI | InChI=1S/C11H19N/c1-7-8(2)10(4)12(6)11(5)9(7)3/h10H,1-6H3 |
| InChIKey | ZEDPFPCQDNHTCP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |