C15H13Cl2NO2 — CID 57046175
3-[2-cyano-2-(3,4-dichlorophenyl)ethenyl]-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 57046175) has the molecular formula C15H13Cl2NO2 and a molecular weight of 310.18 g/mol. Its IUPAC name is 3-[2-cyano-2-(3,4-dichlorophenyl)ethenyl]-2,2-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | 3-[2-cyano-2-(3,4-dichlorophenyl)ethenyl]-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 57046175 |
| Molecular Formula | C15H13Cl2NO2 |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 3-[2-cyano-2-(3,4-dichlorophenyl)ethenyl]-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CC1(C)C(C=C(C#N)c2ccc(Cl)c(Cl)c2)C1C(=O)O |
| InChI | InChI=1S/C15H13Cl2NO2/c1-15(2)10(13(15)14(19)20)5-9(7-18)8-3-4-11(16)12(17)6-8/h3-6,10,13H,1-2H3,(H,19,20) |
| InChIKey | FTFFUOBDGRRNEE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|