C20H28O6 — CID 57046259
2-[(2S)-2-[(1R)-2-[(1S,2S,4aS,8aS)-4-hydroxy-1,2,4a,5-tetramethyl-3-oxo-4,7,8,8a-tetrahydro-2H-naphthalen-1-yl]-1-hydroxyethyl]oxiran-2-yl]-2-oxoacetaldehyde (PubChem CID 57046259) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is 2-[(2S)-2-[(1R)-2-[(1S,2S,4aS,8aS)-4-hydroxy-1,2,4a,5-tetramethyl-3-oxo-4,7,8,8a-tetrahydro-2H-naphthalen-1-yl]-1-hydroxyethyl]oxiran-2-yl]-2-oxoacetaldehyde.
| Compound Name | 2-[(2S)-2-[(1R)-2-[(1S,2S,4aS,8aS)-4-hydroxy-1,2,4a,5-tetramethyl-3-oxo-4,7,8,8a-tetrahydro-2H-naphthalen-1-yl]-1-hydroxyethyl]oxiran-2-yl]-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 57046259 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 2-[(2S)-2-[(1R)-2-[(1S,2S,4aS,8aS)-4-hydroxy-1,2,4a,5-tetramethyl-3-oxo-4,7,8,8a-tetrahydro-2H-naphthalen-1-yl]-1-hydroxyethyl]oxiran-2-yl]-2-oxoacetaldehyde |
| SMILES | CC1=CCC[C@H]2[C@](C)(C[C@@H](O)[C@]3(C(=O)C=O)CO3)[C@H](C)C(=O)C(O)[C@]12C |
| InChI | InChI=1S/C20H28O6/c1-11-6-5-7-13-18(3,12(2)16(24)17(25)19(11,13)4)8-14(22)20(10-26-20)15(23)9-21/h6,9,12-14,17,22,25H,5,7-8,10H2,1-4H3/t12-,13+,14-,17?,18-,19-,20+/m1/s1 |
| InChIKey | FNGCZHJDRGYBCT-XKUCMRFDSA-N |
| XLogP | 1.22 |
| TPSA | 104.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|