About ethyl 4-ethyl-3,6-dihydro-2H-pyridine-1-carboxylate
ethyl 4-ethyl-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 57046336) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is ethyl 4-ethyl-3,6-dihydro-2H-pyridine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-ethyl-3,6-dihydro-2H-pyridine-1-carboxylate |
| PubChem CID | 57046336 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | ethyl 4-ethyl-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CCOC(=O)N1CC=C(CC)CC1 |
| InChI | InChI=1S/C10H17NO2/c1-3-9-5-7-11(8-6-9)10(12)13-4-2/h5H,3-4,6-8H2,1-2H3 |
| InChIKey | PPBKEECGHULHML-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-ethyl-3,6-dihydro-2H-pyridine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-ethyl-3,6-dihydro-2H-pyridine-1-carboxylate?
The IUPAC name of ethyl 4-ethyl-3,6-dihydro-2H-pyridine-1-carboxylate (CID 57046336) is ethyl 4-ethyl-3,6-dihydro-2H-pyridine-1-carboxylate.
What is the SMILES notation for ethyl 4-ethyl-3,6-dihydro-2H-pyridine-1-carboxylate?
The canonical SMILES for ethyl 4-ethyl-3,6-dihydro-2H-pyridine-1-carboxylate is CCOC(=O)N1CC=C(CC)CC1.
What is the InChIKey of ethyl 4-ethyl-3,6-dihydro-2H-pyridine-1-carboxylate?
The InChIKey is PPBKEECGHULHML-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c1-3-9-5-7-11(8-6-9)10(12)13-4-2/h5H,3-4,6-8H2,1-2H3.
What are the key properties of ethyl 4-ethyl-3,6-dihydro-2H-pyridine-1-carboxylate?
ethyl 4-ethyl-3,6-dihydro-2H-pyridine-1-carboxylate has a molecular weight of 183.25 g/mol, XLogP of 2.18, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-ethyl-3,6-dihydro-2H-pyridine-1-carboxylate is sourced from PubChem (CID 57046336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).