C12H12ClNO3 — CID 57046657
2-[3-(2-methoxyphenyl)prop-2-enoylamino]acetyl chloride (PubChem CID 57046657) has the molecular formula C12H12ClNO3 and a molecular weight of 253.69 g/mol. Its IUPAC name is 2-[3-(2-methoxyphenyl)prop-2-enoylamino]acetyl chloride.
| Compound Name | 2-[3-(2-methoxyphenyl)prop-2-enoylamino]acetyl chloride |
|---|---|
| PubChem CID | 57046657 |
| Molecular Formula | C12H12ClNO3 |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 2-[3-(2-methoxyphenyl)prop-2-enoylamino]acetyl chloride |
| SMILES | COc1ccccc1C=CC(=O)NCC(=O)Cl |
| InChI | InChI=1S/C12H12ClNO3/c1-17-10-5-3-2-4-9(10)6-7-12(16)14-8-11(13)15/h2-7H,8H2,1H3,(H,14,16) |
| InChIKey | UJLJWEXLNDVORA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|