About 5-chloro-4-[[4-(4-chlorobutylsulfanyl)-3-methyl-2-pyridinyl]methyl]-2,6-dimethylpyrimidine
5-chloro-4-[[4-(4-chlorobutylsulfanyl)-3-methyl-2-pyridinyl]methyl]-2,6-dimethylpyrimidine (PubChem CID 57046992) has the molecular formula C17H21Cl2N3S
and a molecular weight of 370.35 g/mol. Its IUPAC name is 5-chloro-4-[[4-(4-chlorobutylsulfanyl)-3-methyl-2-pyridinyl]methyl]-2,6-dimethylpyrimidine.
Molecular Properties
| Compound Name | 5-chloro-4-[[4-(4-chlorobutylsulfanyl)-3-methyl-2-pyridinyl]methyl]-2,6-dimethylpyrimidine |
| PubChem CID | 57046992 |
| Molecular Formula | C17H21Cl2N3S |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 5-chloro-4-[[4-(4-chlorobutylsulfanyl)-3-methyl-2-pyridinyl]methyl]-2,6-dimethylpyrimidine |
| SMILES | Cc1nc(C)c(Cl)c(Cc2nccc(SCCCCCl)c2C)n1 |
| InChI | InChI=1S/C17H21Cl2N3S/c1-11-14(10-15-17(19)12(2)21-13(3)22-15)20-8-6-16(11)23-9-5-4-7-18/h6,8H,4-5,7,9-10H2,1-3H3 |
| InChIKey | WWMLACZBPOIMIN-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-4-[[4-(4-chlorobutylsulfanyl)-3-methyl-2-pyridinyl]methyl]-2,6-dimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-[[4-(4-chlorobutylsulfanyl)-3-methyl-2-pyridinyl]methyl]-2,6-dimethylpyrimidine?
The IUPAC name of 5-chloro-4-[[4-(4-chlorobutylsulfanyl)-3-methyl-2-pyridinyl]methyl]-2,6-dimethylpyrimidine (CID 57046992) is 5-chloro-4-[[4-(4-chlorobutylsulfanyl)-3-methyl-2-pyridinyl]methyl]-2,6-dimethylpyrimidine.
What is the SMILES notation for 5-chloro-4-[[4-(4-chlorobutylsulfanyl)-3-methyl-2-pyridinyl]methyl]-2,6-dimethylpyrimidine?
The canonical SMILES for 5-chloro-4-[[4-(4-chlorobutylsulfanyl)-3-methyl-2-pyridinyl]methyl]-2,6-dimethylpyrimidine is Cc1nc(C)c(Cl)c(Cc2nccc(SCCCCCl)c2C)n1.
What is the InChIKey of 5-chloro-4-[[4-(4-chlorobutylsulfanyl)-3-methyl-2-pyridinyl]methyl]-2,6-dimethylpyrimidine?
The InChIKey is WWMLACZBPOIMIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21Cl2N3S/c1-11-14(10-15-17(19)12(2)21-13(3)22-15)20-8-6-16(11)23-9-5-4-7-18/h6,8H,4-5,7,9-10H2,1-3H3.
What are the key properties of 5-chloro-4-[[4-(4-chlorobutylsulfanyl)-3-methyl-2-pyridinyl]methyl]-2,6-dimethylpyrimidine?
5-chloro-4-[[4-(4-chlorobutylsulfanyl)-3-methyl-2-pyridinyl]methyl]-2,6-dimethylpyrimidine has a molecular weight of 370.35 g/mol, XLogP of 5.15, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-[[4-(4-chlorobutylsulfanyl)-3-methyl-2-pyridinyl]methyl]-2,6-dimethylpyrimidine is sourced from PubChem (CID 57046992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).