C13H24O7 — CID 57047077
2-[(1R,2S,3R,5S)-2-[(R)-3,4-dihydroxybutoxy(methoxy)methyl]-3,5-dihydroxycyclopentyl]acetaldehyde (PubChem CID 57047077) has the molecular formula C13H24O7 and a molecular weight of 292.33 g/mol. Its IUPAC name is 2-[(1R,2S,3R,5S)-2-[(R)-3,4-dihydroxybutoxy(methoxy)methyl]-3,5-dihydroxycyclopentyl]acetaldehyde.
| Compound Name | 2-[(1R,2S,3R,5S)-2-[(R)-3,4-dihydroxybutoxy(methoxy)methyl]-3,5-dihydroxycyclopentyl]acetaldehyde |
|---|---|
| PubChem CID | 57047077 |
| Molecular Formula | C13H24O7 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 2-[(1R,2S,3R,5S)-2-[(R)-3,4-dihydroxybutoxy(methoxy)methyl]-3,5-dihydroxycyclopentyl]acetaldehyde |
| SMILES | CO[C@H](OCCC(O)CO)[C@H]1[C@@H](CC=O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C13H24O7/c1-19-13(20-5-3-8(16)7-15)12-9(2-4-14)10(17)6-11(12)18/h4,8-13,15-18H,2-3,5-7H2,1H3/t8?,9-,10-,11+,12-,13+/m0/s1 |
| InChIKey | KMBYFSQAIBBHSI-NQRNMBKZSA-N |
| XLogP | -1.33 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|