About 3-nitro-2,3-dihydropyridine
3-nitro-2,3-dihydropyridine (PubChem CID 57047118) has the molecular formula C5H6N2O2
and a molecular weight of 126.11 g/mol. Its IUPAC name is 3-nitro-2,3-dihydropyridine.
Molecular Properties
| Compound Name | 3-nitro-2,3-dihydropyridine |
| PubChem CID | 57047118 |
| Molecular Formula | C5H6N2O2 |
| Molecular Weight | 126.11 g/mol |
| Exact Mass | 126.04 |
| IUPAC Name | 3-nitro-2,3-dihydropyridine |
| SMILES | O=[N+]([O-])C1C=CC=NC1 |
| InChI | InChI=1S/C5H6N2O2/c8-7(9)5-2-1-3-6-4-5/h1-3,5H,4H2 |
| InChIKey | PLUAADCXRYVDFQ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.11 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitro-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitro-2,3-dihydropyridine?
The IUPAC name of 3-nitro-2,3-dihydropyridine (CID 57047118) is 3-nitro-2,3-dihydropyridine.
What is the SMILES notation for 3-nitro-2,3-dihydropyridine?
The canonical SMILES for 3-nitro-2,3-dihydropyridine is O=[N+]([O-])C1C=CC=NC1.
What is the InChIKey of 3-nitro-2,3-dihydropyridine?
The InChIKey is PLUAADCXRYVDFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O2/c8-7(9)5-2-1-3-6-4-5/h1-3,5H,4H2.
What are the key properties of 3-nitro-2,3-dihydropyridine?
3-nitro-2,3-dihydropyridine has a molecular weight of 126.11 g/mol, XLogP of 0.27, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitro-2,3-dihydropyridine is sourced from PubChem (CID 57047118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).