C36H35NO2 — CID 57047212
7-[2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)ethylidene]-2,3-diphenylindolizin-1-one (PubChem CID 57047212) has the molecular formula C36H35NO2 and a molecular weight of 513.68 g/mol. Its IUPAC name is 7-[2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)ethylidene]-2,3-diphenylindolizin-1-one.
| Compound Name | 7-[2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)ethylidene]-2,3-diphenylindolizin-1-one |
|---|---|
| PubChem CID | 57047212 |
| Molecular Formula | C36H35NO2 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | 7-[2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)ethylidene]-2,3-diphenylindolizin-1-one |
| SMILES | CC(C)(C)C1=CC(=CC=C2C=CN3C(=C2)C(=O)C(c2ccccc2)=C3c2ccccc2)C=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C36H35NO2/c1-35(2,3)28-21-25(22-29(33(28)38)36(4,5)6)18-17-24-19-20-37-30(23-24)34(39)31(26-13-9-7-10-14-26)32(37)27-15-11-8-12-16-27/h7-23H,1-6H3 |
| InChIKey | CASPIIBCIGFKAP-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|