About (prop-1-en-2-ylamino) 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate
(prop-1-en-2-ylamino) 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate (PubChem CID 57047295) has the molecular formula C19H18F3NO4
and a molecular weight of 381.35 g/mol. Its IUPAC name is (prop-1-en-2-ylamino) 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate.
Molecular Properties
| Compound Name | (prop-1-en-2-ylamino) 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate |
| PubChem CID | 57047295 |
| Molecular Formula | C19H18F3NO4 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | (prop-1-en-2-ylamino) 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate |
| SMILES | C=C(C)NOC(=O)C(C)Oc1ccc(Oc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H18F3NO4/c1-12(2)23-27-18(24)13(3)25-15-8-10-17(11-9-15)26-16-6-4-14(5-7-16)19(20,21)22/h4-11,13,23H,1H2,2-3H3 |
| InChIKey | SDFVINKXRCTBRI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (prop-1-en-2-ylamino) 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (prop-1-en-2-ylamino) 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate?
The IUPAC name of (prop-1-en-2-ylamino) 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate (CID 57047295) is (prop-1-en-2-ylamino) 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate.
What is the SMILES notation for (prop-1-en-2-ylamino) 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate?
The canonical SMILES for (prop-1-en-2-ylamino) 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate is C=C(C)NOC(=O)C(C)Oc1ccc(Oc2ccc(C(F)(F)F)cc2)cc1.
What is the InChIKey of (prop-1-en-2-ylamino) 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate?
The InChIKey is SDFVINKXRCTBRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18F3NO4/c1-12(2)23-27-18(24)13(3)25-15-8-10-17(11-9-15)26-16-6-4-14(5-7-16)19(20,21)22/h4-11,13,23H,1H2,2-3H3.
What are the key properties of (prop-1-en-2-ylamino) 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate?
(prop-1-en-2-ylamino) 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate has a molecular weight of 381.35 g/mol, XLogP of 4.85, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (prop-1-en-2-ylamino) 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate is sourced from PubChem (CID 57047295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).