About (5S)-5-tert-butylsulfanyl-3,6-dimethyloctan-4-ol
(5S)-5-tert-butylsulfanyl-3,6-dimethyloctan-4-ol (PubChem CID 57047335) has the molecular formula C14H30OS
and a molecular weight of 246.46 g/mol. Its IUPAC name is (5S)-5-tert-butylsulfanyl-3,6-dimethyloctan-4-ol.
Molecular Properties
| Compound Name | (5S)-5-tert-butylsulfanyl-3,6-dimethyloctan-4-ol |
| PubChem CID | 57047335 |
| Molecular Formula | C14H30OS |
| Molecular Weight | 246.46 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | (5S)-5-tert-butylsulfanyl-3,6-dimethyloctan-4-ol |
| SMILES | CCC(C)C(O)[C@@H](SC(C)(C)C)C(C)CC |
| InChI | InChI=1S/C14H30OS/c1-8-10(3)12(15)13(11(4)9-2)16-14(5,6)7/h10-13,15H,8-9H2,1-7H3/t10?,11?,12?,13-/m0/s1 |
| InChIKey | VNDGDVVKKWGYIL-SKQCGHHBSA-N |
| XLogP | 4.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-5-tert-butylsulfanyl-3,6-dimethyloctan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-tert-butylsulfanyl-3,6-dimethyloctan-4-ol?
The IUPAC name of (5S)-5-tert-butylsulfanyl-3,6-dimethyloctan-4-ol (CID 57047335) is (5S)-5-tert-butylsulfanyl-3,6-dimethyloctan-4-ol.
What is the SMILES notation for (5S)-5-tert-butylsulfanyl-3,6-dimethyloctan-4-ol?
The canonical SMILES for (5S)-5-tert-butylsulfanyl-3,6-dimethyloctan-4-ol is CCC(C)C(O)[C@@H](SC(C)(C)C)C(C)CC.
What is the InChIKey of (5S)-5-tert-butylsulfanyl-3,6-dimethyloctan-4-ol?
The InChIKey is VNDGDVVKKWGYIL-SKQCGHHBSA-N. The full InChI is InChI=1S/C14H30OS/c1-8-10(3)12(15)13(11(4)9-2)16-14(5,6)7/h10-13,15H,8-9H2,1-7H3/t10?,11?,12?,13-/m0/s1.
What are the key properties of (5S)-5-tert-butylsulfanyl-3,6-dimethyloctan-4-ol?
(5S)-5-tert-butylsulfanyl-3,6-dimethyloctan-4-ol has a molecular weight of 246.46 g/mol, XLogP of 4.34, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-tert-butylsulfanyl-3,6-dimethyloctan-4-ol is sourced from PubChem (CID 57047335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).