About 2-chloro-3,3-bis(fluoromethyl)-2-methylcyclopropane-1-carboxylic acid
2-chloro-3,3-bis(fluoromethyl)-2-methylcyclopropane-1-carboxylic acid (PubChem CID 57047526) has the molecular formula C7H9ClF2O2
and a molecular weight of 198.60 g/mol. Its IUPAC name is 2-chloro-3,3-bis(fluoromethyl)-2-methylcyclopropane-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-chloro-3,3-bis(fluoromethyl)-2-methylcyclopropane-1-carboxylic acid |
| PubChem CID | 57047526 |
| Molecular Formula | C7H9ClF2O2 |
| Molecular Weight | 198.60 g/mol |
| Exact Mass | 198.03 |
| IUPAC Name | 2-chloro-3,3-bis(fluoromethyl)-2-methylcyclopropane-1-carboxylic acid |
| SMILES | CC1(Cl)C(C(=O)O)C1(CF)CF |
| InChI | InChI=1S/C7H9ClF2O2/c1-6(8)4(5(11)12)7(6,2-9)3-10/h4H,2-3H2,1H3,(H,11,12) |
| InChIKey | QSCPZLQWXHTMKH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.60 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3,3-bis(fluoromethyl)-2-methylcyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3,3-bis(fluoromethyl)-2-methylcyclopropane-1-carboxylic acid?
The IUPAC name of 2-chloro-3,3-bis(fluoromethyl)-2-methylcyclopropane-1-carboxylic acid (CID 57047526) is 2-chloro-3,3-bis(fluoromethyl)-2-methylcyclopropane-1-carboxylic acid.
What is the SMILES notation for 2-chloro-3,3-bis(fluoromethyl)-2-methylcyclopropane-1-carboxylic acid?
The canonical SMILES for 2-chloro-3,3-bis(fluoromethyl)-2-methylcyclopropane-1-carboxylic acid is CC1(Cl)C(C(=O)O)C1(CF)CF.
What is the InChIKey of 2-chloro-3,3-bis(fluoromethyl)-2-methylcyclopropane-1-carboxylic acid?
The InChIKey is QSCPZLQWXHTMKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClF2O2/c1-6(8)4(5(11)12)7(6,2-9)3-10/h4H,2-3H2,1H3,(H,11,12).
What are the key properties of 2-chloro-3,3-bis(fluoromethyl)-2-methylcyclopropane-1-carboxylic acid?
2-chloro-3,3-bis(fluoromethyl)-2-methylcyclopropane-1-carboxylic acid has a molecular weight of 198.60 g/mol, XLogP of 1.62, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3,3-bis(fluoromethyl)-2-methylcyclopropane-1-carboxylic acid is sourced from PubChem (CID 57047526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).