C20H20Cl2N2O3S — CID 57047745
(1S,2R,3S,5S)-3-(2-benzylsulfanyl-5,6-dichlorobenzimidazol-1-yl)-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 57047745) has the molecular formula C20H20Cl2N2O3S and a molecular weight of 439.36 g/mol. Its IUPAC name is (1S,2R,3S,5S)-3-(2-benzylsulfanyl-5,6-dichlorobenzimidazol-1-yl)-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3S,5S)-3-(2-benzylsulfanyl-5,6-dichlorobenzimidazol-1-yl)-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 57047745 |
| Molecular Formula | C20H20Cl2N2O3S |
| Molecular Weight | 439.36 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | (1S,2R,3S,5S)-3-(2-benzylsulfanyl-5,6-dichlorobenzimidazol-1-yl)-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | OC[C@@H]1C[C@H](n2c(SCc3ccccc3)nc3cc(Cl)c(Cl)cc32)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H20Cl2N2O3S/c21-13-7-15-16(8-14(13)22)24(17-6-12(9-25)18(26)19(17)27)20(23-15)28-10-11-4-2-1-3-5-11/h1-5,7-8,12,17-19,25-27H,6,9-10H2/t12-,17-,18-,19+/m0/s1 |
| InChIKey | KOXZYBBNYWWBIP-OZOSWLFCSA-N |
| XLogP | 3.91 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |