C16H16FN — CID 57047788
4-(3-fluorophenyl)-4,4a,5,6-tetrahydro-3H-naphthalen-2-imine (PubChem CID 57047788) has the molecular formula C16H16FN and a molecular weight of 241.31 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-4,4a,5,6-tetrahydro-3H-naphthalen-2-imine.
| Compound Name | 4-(3-fluorophenyl)-4,4a,5,6-tetrahydro-3H-naphthalen-2-imine |
|---|---|
| PubChem CID | 57047788 |
| Molecular Formula | C16H16FN |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 4-(3-fluorophenyl)-4,4a,5,6-tetrahydro-3H-naphthalen-2-imine |
| SMILES | [H]/N=C1\C=C2C=CCCC2C(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C16H16FN/c17-13-6-3-5-11(8-13)16-10-14(18)9-12-4-1-2-7-15(12)16/h1,3-6,8-9,15-16,18H,2,7,10H2/b18-14+ |
| InChIKey | QTAORYLJBJHMQV-NBVRZTHBSA-N |
| XLogP | 4.23 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|