About dimethyl 4-[1-[2-(4-methylphenyl)sulfonylhydrazinyl]ethenyl]cyclohex-4-ene-1,2-dicarboxylate
dimethyl 4-[1-[2-(4-methylphenyl)sulfonylhydrazinyl]ethenyl]cyclohex-4-ene-1,2-dicarboxylate (PubChem CID 57047857) has the molecular formula C19H24N2O6S
and a molecular weight of 408.48 g/mol. Its IUPAC name is dimethyl 4-[1-[2-(4-methylphenyl)sulfonylhydrazinyl]ethenyl]cyclohex-4-ene-1,2-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 4-[1-[2-(4-methylphenyl)sulfonylhydrazinyl]ethenyl]cyclohex-4-ene-1,2-dicarboxylate |
| PubChem CID | 57047857 |
| Molecular Formula | C19H24N2O6S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | dimethyl 4-[1-[2-(4-methylphenyl)sulfonylhydrazinyl]ethenyl]cyclohex-4-ene-1,2-dicarboxylate |
| SMILES | C=C(NNS(=O)(=O)c1ccc(C)cc1)C1=CCC(C(=O)OC)C(C(=O)OC)C1 |
| InChI | InChI=1S/C19H24N2O6S/c1-12-5-8-15(9-6-12)28(24,25)21-20-13(2)14-7-10-16(18(22)26-3)17(11-14)19(23)27-4/h5-9,16-17,20-21H,2,10-11H2,1,3-4H3 |
| InChIKey | FQLCEBWZKJKJNJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 4-[1-[2-(4-methylphenyl)sulfonylhydrazinyl]ethenyl]cyclohex-4-ene-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 4-[1-[2-(4-methylphenyl)sulfonylhydrazinyl]ethenyl]cyclohex-4-ene-1,2-dicarboxylate?
The IUPAC name of dimethyl 4-[1-[2-(4-methylphenyl)sulfonylhydrazinyl]ethenyl]cyclohex-4-ene-1,2-dicarboxylate (CID 57047857) is dimethyl 4-[1-[2-(4-methylphenyl)sulfonylhydrazinyl]ethenyl]cyclohex-4-ene-1,2-dicarboxylate.
What is the SMILES notation for dimethyl 4-[1-[2-(4-methylphenyl)sulfonylhydrazinyl]ethenyl]cyclohex-4-ene-1,2-dicarboxylate?
The canonical SMILES for dimethyl 4-[1-[2-(4-methylphenyl)sulfonylhydrazinyl]ethenyl]cyclohex-4-ene-1,2-dicarboxylate is C=C(NNS(=O)(=O)c1ccc(C)cc1)C1=CCC(C(=O)OC)C(C(=O)OC)C1.
What is the InChIKey of dimethyl 4-[1-[2-(4-methylphenyl)sulfonylhydrazinyl]ethenyl]cyclohex-4-ene-1,2-dicarboxylate?
The InChIKey is FQLCEBWZKJKJNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2O6S/c1-12-5-8-15(9-6-12)28(24,25)21-20-13(2)14-7-10-16(18(22)26-3)17(11-14)19(23)27-4/h5-9,16-17,20-21H,2,10-11H2,1,3-4H3.
What are the key properties of dimethyl 4-[1-[2-(4-methylphenyl)sulfonylhydrazinyl]ethenyl]cyclohex-4-ene-1,2-dicarboxylate?
dimethyl 4-[1-[2-(4-methylphenyl)sulfonylhydrazinyl]ethenyl]cyclohex-4-ene-1,2-dicarboxylate has a molecular weight of 408.48 g/mol, XLogP of 1.59, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 4-[1-[2-(4-methylphenyl)sulfonylhydrazinyl]ethenyl]cyclohex-4-ene-1,2-dicarboxylate is sourced from PubChem (CID 57047857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).