C23H22N2O — CID 57048018
3-[(2-amino-3,3-diphenylpropoxy)methyl]benzonitrile (PubChem CID 57048018) has the molecular formula C23H22N2O and a molecular weight of 342.44 g/mol. Its IUPAC name is 3-[(2-amino-3,3-diphenylpropoxy)methyl]benzonitrile.
| Compound Name | 3-[(2-amino-3,3-diphenylpropoxy)methyl]benzonitrile |
|---|---|
| PubChem CID | 57048018 |
| Molecular Formula | C23H22N2O |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 3-[(2-amino-3,3-diphenylpropoxy)methyl]benzonitrile |
| SMILES | N#Cc1cccc(COCC(N)C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C23H22N2O/c24-15-18-8-7-9-19(14-18)16-26-17-22(25)23(20-10-3-1-4-11-20)21-12-5-2-6-13-21/h1-14,22-23H,16-17,25H2 |
| InChIKey | IXHINNOHTKAERJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |