C18H24N4O3 — CID 57048268
ethyl 2-[4-[[2-(4-cyanoanilino)-2-oxoethyl]amino]piperidin-1-yl]acetate (PubChem CID 57048268) has the molecular formula C18H24N4O3 and a molecular weight of 344.41 g/mol. Its IUPAC name is ethyl 2-[4-[[2-(4-cyanoanilino)-2-oxoethyl]amino]piperidin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[[2-(4-cyanoanilino)-2-oxoethyl]amino]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 57048268 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | ethyl 2-[4-[[2-(4-cyanoanilino)-2-oxoethyl]amino]piperidin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCC(NCC(=O)Nc2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C18H24N4O3/c1-2-25-18(24)13-22-9-7-15(8-10-22)20-12-17(23)21-16-5-3-14(11-19)4-6-16/h3-6,15,20H,2,7-10,12-13H2,1H3,(H,21,23) |
| InChIKey | VDXAFUNSAWLGCR-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |