C22H29N3O3S — CID 57048277
[2-methyl-3-(5-nonyl-1,3,4-oxadiazol-2-yl)-1,2-benzothiazin-4-yl] acetate (PubChem CID 57048277) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is [2-methyl-3-(5-nonyl-1,3,4-oxadiazol-2-yl)-1,2-benzothiazin-4-yl] acetate.
| Compound Name | [2-methyl-3-(5-nonyl-1,3,4-oxadiazol-2-yl)-1,2-benzothiazin-4-yl] acetate |
|---|---|
| PubChem CID | 57048277 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | [2-methyl-3-(5-nonyl-1,3,4-oxadiazol-2-yl)-1,2-benzothiazin-4-yl] acetate |
| SMILES | CCCCCCCCCc1nnc(C2=C(OC(C)=O)c3ccccc3SN2C)o1 |
| InChI | InChI=1S/C22H29N3O3S/c1-4-5-6-7-8-9-10-15-19-23-24-22(28-19)20-21(27-16(2)26)17-13-11-12-14-18(17)29-25(20)3/h11-14H,4-10,15H2,1-3H3 |
| InChIKey | WKOIACQITKYALO-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|