C23H34N2 — CID 57048563
(2S,12R)-2-cycloheptyl-11,14-diazatetracyclo[9.6.1.05,18.012,17]octadeca-1(17),5(18),8-triene (PubChem CID 57048563) has the molecular formula C23H34N2 and a molecular weight of 338.54 g/mol. Its IUPAC name is (2S,12R)-2-cycloheptyl-11,14-diazatetracyclo[9.6.1.05,18.012,17]octadeca-1(17),5(18),8-triene.
| Compound Name | (2S,12R)-2-cycloheptyl-11,14-diazatetracyclo[9.6.1.05,18.012,17]octadeca-1(17),5(18),8-triene |
|---|---|
| PubChem CID | 57048563 |
| Molecular Formula | C23H34N2 |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.27 |
| IUPAC Name | (2S,12R)-2-cycloheptyl-11,14-diazatetracyclo[9.6.1.05,18.012,17]octadeca-1(17),5(18),8-triene |
| SMILES | C1=CCN2C3=C(CC1)CC[C@@H](C1CCCCCC1)C3=C1CCNC[C@@H]12 |
| InChI | InChI=1S/C23H34N2/c1-2-5-9-17(8-4-1)19-12-11-18-10-6-3-7-15-25-21-16-24-14-13-20(21)22(19)23(18)25/h3,7,17,19,21,24H,1-2,4-6,8-16H2/t19-,21-/m0/s1 |
| InChIKey | PJWAHQYXSNNNSL-FPOVZHCZSA-N |
| XLogP | 4.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|