C18H38O — CID 57048725
3,5,5-trimethyl-1-(3,5,5-trimethylhexoxy)hexane (PubChem CID 57048725) has the molecular formula C18H38O and a molecular weight of 270.50 g/mol. Its IUPAC name is 3,5,5-trimethyl-1-(3,5,5-trimethylhexoxy)hexane.
| Compound Name | 3,5,5-trimethyl-1-(3,5,5-trimethylhexoxy)hexane |
|---|---|
| PubChem CID | 57048725 |
| Molecular Formula | C18H38O |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.29 |
| IUPAC Name | 3,5,5-trimethyl-1-(3,5,5-trimethylhexoxy)hexane |
| SMILES | CC(CCOCCC(C)CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C18H38O/c1-15(13-17(3,4)5)9-11-19-12-10-16(2)14-18(6,7)8/h15-16H,9-14H2,1-8H3 |
| InChIKey | QMXSDNCTBYAHCX-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|