C5H4Cl3F3O — CID 57049943
1,4,4-trichloro-5,5,5-trifluoropentan-2-one (PubChem CID 57049943) has the molecular formula C5H4Cl3F3O and a molecular weight of 243.44 g/mol. Its IUPAC name is 1,4,4-trichloro-5,5,5-trifluoropentan-2-one.
| Compound Name | 1,4,4-trichloro-5,5,5-trifluoropentan-2-one |
|---|---|
| PubChem CID | 57049943 |
| Molecular Formula | C5H4Cl3F3O |
| Molecular Weight | 243.44 g/mol |
| Exact Mass | 241.93 |
| IUPAC Name | 1,4,4-trichloro-5,5,5-trifluoropentan-2-one |
| SMILES | O=C(CCl)CC(Cl)(Cl)C(F)(F)F |
| InChI | InChI=1S/C5H4Cl3F3O/c6-2-3(12)1-4(7,8)5(9,10)11/h1-2H2 |
| InChIKey | YOCGJGDMZLOYFU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|