C20H29Cl — CID 57050049
1-chloro-4-(1,2-dicyclohexylethyl)benzene (PubChem CID 57050049) has the molecular formula C20H29Cl and a molecular weight of 304.90 g/mol. Its IUPAC name is 1-chloro-4-(1,2-dicyclohexylethyl)benzene.
| Compound Name | 1-chloro-4-(1,2-dicyclohexylethyl)benzene |
|---|---|
| PubChem CID | 57050049 |
| Molecular Formula | C20H29Cl |
| Molecular Weight | 304.90 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 1-chloro-4-(1,2-dicyclohexylethyl)benzene |
| SMILES | Clc1ccc(C(CC2CCCCC2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C20H29Cl/c21-19-13-11-18(12-14-19)20(17-9-5-2-6-10-17)15-16-7-3-1-4-8-16/h11-14,16-17,20H,1-10,15H2 |
| InChIKey | ICXCLWJWCYOWJN-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.90 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |