C28H52N2O4 — CID 57050083
10-oxo-9-(2,2,6,6-tetramethylpiperidin-4-yl)-10-(2,2,6,6-tetramethylpiperidin-4-yl)oxydecanoic acid (PubChem CID 57050083) has the molecular formula C28H52N2O4 and a molecular weight of 480.73 g/mol. Its IUPAC name is 10-oxo-9-(2,2,6,6-tetramethylpiperidin-4-yl)-10-(2,2,6,6-tetramethylpiperidin-4-yl)oxydecanoic acid.
| Compound Name | 10-oxo-9-(2,2,6,6-tetramethylpiperidin-4-yl)-10-(2,2,6,6-tetramethylpiperidin-4-yl)oxydecanoic acid |
|---|---|
| PubChem CID | 57050083 |
| Molecular Formula | C28H52N2O4 |
| Molecular Weight | 480.73 g/mol |
| Exact Mass | 480.39 |
| IUPAC Name | 10-oxo-9-(2,2,6,6-tetramethylpiperidin-4-yl)-10-(2,2,6,6-tetramethylpiperidin-4-yl)oxydecanoic acid |
| SMILES | CC1(C)CC(OC(=O)C(CCCCCCCC(=O)O)C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C28H52N2O4/c1-25(2)16-20(17-26(3,4)29-25)22(14-12-10-9-11-13-15-23(31)32)24(33)34-21-18-27(5,6)30-28(7,8)19-21/h20-22,29-30H,9-19H2,1-8H3,(H,31,32) |
| InChIKey | RZWGOUKOTWCKLU-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.73 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|