About S-phenyl 3-phenylpropanethioate
S-phenyl 3-phenylpropanethioate (PubChem CID 570502) has the molecular formula C15H14OS
and a molecular weight of 242.34 g/mol. Its IUPAC name is S-phenyl 3-phenylpropanethioate.
Molecular Properties
| Compound Name | S-phenyl 3-phenylpropanethioate |
| PubChem CID | 570502 |
| Molecular Formula | C15H14OS |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | S-phenyl 3-phenylpropanethioate |
| SMILES | O=C(CCc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C15H14OS/c16-15(17-14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-10H,11-12H2 |
| InChIKey | OHMMFCQYKLBWSI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-phenyl 3-phenylpropanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-phenyl 3-phenylpropanethioate?
The IUPAC name of S-phenyl 3-phenylpropanethioate (CID 570502) is S-phenyl 3-phenylpropanethioate.
What is the SMILES notation for S-phenyl 3-phenylpropanethioate?
The canonical SMILES for S-phenyl 3-phenylpropanethioate is O=C(CCc1ccccc1)Sc1ccccc1.
What is the InChIKey of S-phenyl 3-phenylpropanethioate?
The InChIKey is OHMMFCQYKLBWSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14OS/c16-15(17-14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-10H,11-12H2.
What are the key properties of S-phenyl 3-phenylpropanethioate?
S-phenyl 3-phenylpropanethioate has a molecular weight of 242.34 g/mol, XLogP of 3.94, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-phenyl 3-phenylpropanethioate is sourced from PubChem (CID 570502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).