C19H33NO4 — CID 57050469
2-[1-(diethylamino)-5,9-dimethyldeca-4,8-dien-3-yl]propanedioic acid (PubChem CID 57050469) has the molecular formula C19H33NO4 and a molecular weight of 339.48 g/mol. Its IUPAC name is 2-[1-(diethylamino)-5,9-dimethyldeca-4,8-dien-3-yl]propanedioic acid.
| Compound Name | 2-[1-(diethylamino)-5,9-dimethyldeca-4,8-dien-3-yl]propanedioic acid |
|---|---|
| PubChem CID | 57050469 |
| Molecular Formula | C19H33NO4 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | 2-[1-(diethylamino)-5,9-dimethyldeca-4,8-dien-3-yl]propanedioic acid |
| SMILES | CCN(CC)CCC(C=C(C)CCC=C(C)C)C(C(=O)O)C(=O)O |
| InChI | InChI=1S/C19H33NO4/c1-6-20(7-2)12-11-16(17(18(21)22)19(23)24)13-15(5)10-8-9-14(3)4/h9,13,16-17H,6-8,10-12H2,1-5H3,(H,21,22)(H,23,24) |
| InChIKey | TURALJBPRJZSHJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|