C26H42O5 — CID 57050868
methyl 7-[(1R,2S,3R)-2-[(1S)-1-acetyloxy-4,4-dimethyloct-2-enyl]-3-methyl-5-oxocyclopentyl]hept-5-enoate (PubChem CID 57050868) has the molecular formula C26H42O5 and a molecular weight of 434.62 g/mol. Its IUPAC name is methyl 7-[(1R,2S,3R)-2-[(1S)-1-acetyloxy-4,4-dimethyloct-2-enyl]-3-methyl-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2S,3R)-2-[(1S)-1-acetyloxy-4,4-dimethyloct-2-enyl]-3-methyl-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 57050868 |
| Molecular Formula | C26H42O5 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | methyl 7-[(1R,2S,3R)-2-[(1S)-1-acetyloxy-4,4-dimethyloct-2-enyl]-3-methyl-5-oxocyclopentyl]hept-5-enoate |
| SMILES | CCCCC(C)(C)C=C[C@H](OC(C)=O)[C@H]1[C@H](C)CC(=O)[C@@H]1CC=CCCCC(=O)OC |
| InChI | InChI=1S/C26H42O5/c1-7-8-16-26(4,5)17-15-23(31-20(3)27)25-19(2)18-22(28)21(25)13-11-9-10-12-14-24(29)30-6/h9,11,15,17,19,21,23,25H,7-8,10,12-14,16,18H2,1-6H3/t19-,21+,23+,25+/m1/s1 |
| InChIKey | SUPGMNDMROXHCB-UYGRPXGYSA-N |
| XLogP | 5.82 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|