C25H32F3NO4S — CID 57051098
7-[6,6-dimethyl-3-[2-[3-(trifluoromethyl)phenyl]ethylsulfonylamino]-2-bicyclo[3.1.1]hept-2-enyl]hept-5-enoic acid (PubChem CID 57051098) has the molecular formula C25H32F3NO4S and a molecular weight of 499.60 g/mol. Its IUPAC name is 7-[6,6-dimethyl-3-[2-[3-(trifluoromethyl)phenyl]ethylsulfonylamino]-2-bicyclo[3.1.1]hept-2-enyl]hept-5-enoic acid.
| Compound Name | 7-[6,6-dimethyl-3-[2-[3-(trifluoromethyl)phenyl]ethylsulfonylamino]-2-bicyclo[3.1.1]hept-2-enyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 57051098 |
| Molecular Formula | C25H32F3NO4S |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 7-[6,6-dimethyl-3-[2-[3-(trifluoromethyl)phenyl]ethylsulfonylamino]-2-bicyclo[3.1.1]hept-2-enyl]hept-5-enoic acid |
| SMILES | CC1(C)C2CC(NS(=O)(=O)CCc3cccc(C(F)(F)F)c3)=C(CC=CCCCC(=O)O)C1C2 |
| InChI | InChI=1S/C25H32F3NO4S/c1-24(2)19-15-21(24)20(10-5-3-4-6-11-23(30)31)22(16-19)29-34(32,33)13-12-17-8-7-9-18(14-17)25(26,27)28/h3,5,7-9,14,19,21,29H,4,6,10-13,15-16H2,1-2H3,(H,30,31) |
| InChIKey | PORXAMGFIOBTHI-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|