C12H15N3OS — CID 57051185
N-(diaminomethylidene)-3,5-dimethyl-2,3-dihydro-1-benzothiophene-6-carboxamide (PubChem CID 57051185) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is N-(diaminomethylidene)-3,5-dimethyl-2,3-dihydro-1-benzothiophene-6-carboxamide.
| Compound Name | N-(diaminomethylidene)-3,5-dimethyl-2,3-dihydro-1-benzothiophene-6-carboxamide |
|---|---|
| PubChem CID | 57051185 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | N-(diaminomethylidene)-3,5-dimethyl-2,3-dihydro-1-benzothiophene-6-carboxamide |
| SMILES | Cc1cc2c(cc1C(=O)N=C(N)N)SCC2C |
| InChI | InChI=1S/C12H15N3OS/c1-6-3-8-7(2)5-17-10(8)4-9(6)11(16)15-12(13)14/h3-4,7H,5H2,1-2H3,(H4,13,14,15,16) |
| InChIKey | CAZZQIQSCGXTEN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|