C12H18Cl4 — CID 57051190
5,6,9,10-tetrachlorododeca-1,2-diene (PubChem CID 57051190) has the molecular formula C12H18Cl4 and a molecular weight of 304.09 g/mol. Its IUPAC name is 5,6,9,10-tetrachlorododeca-1,2-diene.
| Compound Name | 5,6,9,10-tetrachlorododeca-1,2-diene |
|---|---|
| PubChem CID | 57051190 |
| Molecular Formula | C12H18Cl4 |
| Molecular Weight | 304.09 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 5,6,9,10-tetrachlorododeca-1,2-diene |
| SMILES | C=C=CCC(Cl)C(Cl)CCC(Cl)C(Cl)CC |
| InChI | InChI=1S/C12H18Cl4/c1-3-5-6-10(14)12(16)8-7-11(15)9(13)4-2/h5,9-12H,1,4,6-8H2,2H3 |
| InChIKey | WIKQXNVTKFNQMS-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.09 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|