C20H23N5O6S2 — CID 57051273
3-(acetyloxymethyl)-7-[[2-[4-(carbamohydrazonoylsulfanylmethyl)phenyl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 57051273) has the molecular formula C20H23N5O6S2 and a molecular weight of 493.57 g/mol. Its IUPAC name is 3-(acetyloxymethyl)-7-[[2-[4-(carbamohydrazonoylsulfanylmethyl)phenyl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | 3-(acetyloxymethyl)-7-[[2-[4-(carbamohydrazonoylsulfanylmethyl)phenyl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 57051273 |
| Molecular Formula | C20H23N5O6S2 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | 3-(acetyloxymethyl)-7-[[2-[4-(carbamohydrazonoylsulfanylmethyl)phenyl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CC(=O)OCC1=C(C(=O)O)N2C(=O)C(NC(=O)Cc3ccc(CSC(N)=NN)cc3)C2SC1 |
| InChI | InChI=1S/C20H23N5O6S2/c1-10(26)31-7-13-9-32-18-15(17(28)25(18)16(13)19(29)30)23-14(27)6-11-2-4-12(5-3-11)8-33-20(21)24-22/h2-5,15,18H,6-9,22H2,1H3,(H2,21,24)(H,23,27)(H,29,30) |
| InChIKey | GISMJKMOLJUAAS-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 177.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|