About 4-ethynylhepta-1,6-diyne
4-ethynylhepta-1,6-diyne (PubChem CID 57051480) has the molecular formula C9H8
and a molecular weight of 116.16 g/mol. Its IUPAC name is 4-ethynylhepta-1,6-diyne.
Molecular Properties
| Compound Name | 4-ethynylhepta-1,6-diyne |
| PubChem CID | 57051480 |
| Molecular Formula | C9H8 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.06 |
| IUPAC Name | 4-ethynylhepta-1,6-diyne |
| SMILES | C#CCC(C#C)CC#C |
| InChI | InChI=1S/C9H8/c1-4-7-9(6-3)8-5-2/h1-3,9H,7-8H2 |
| InChIKey | CZCXPOMRZQRDPA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethynylhepta-1,6-diyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethynylhepta-1,6-diyne?
The IUPAC name of 4-ethynylhepta-1,6-diyne (CID 57051480) is 4-ethynylhepta-1,6-diyne.
What is the SMILES notation for 4-ethynylhepta-1,6-diyne?
The canonical SMILES for 4-ethynylhepta-1,6-diyne is C#CCC(C#C)CC#C.
What is the InChIKey of 4-ethynylhepta-1,6-diyne?
The InChIKey is CZCXPOMRZQRDPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8/c1-4-7-9(6-3)8-5-2/h1-3,9H,7-8H2.
What are the key properties of 4-ethynylhepta-1,6-diyne?
4-ethynylhepta-1,6-diyne has a molecular weight of 116.16 g/mol, XLogP of 1.28, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethynylhepta-1,6-diyne is sourced from PubChem (CID 57051480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).