About 2-tert-butyl-4-decyl-1,3-oxazole
2-tert-butyl-4-decyl-1,3-oxazole (PubChem CID 57051564) has the molecular formula C17H31NO
and a molecular weight of 265.44 g/mol. Its IUPAC name is 2-tert-butyl-4-decyl-1,3-oxazole.
Molecular Properties
| Compound Name | 2-tert-butyl-4-decyl-1,3-oxazole |
| PubChem CID | 57051564 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | 2-tert-butyl-4-decyl-1,3-oxazole |
| SMILES | CCCCCCCCCCc1coc(C(C)(C)C)n1 |
| InChI | InChI=1S/C17H31NO/c1-5-6-7-8-9-10-11-12-13-15-14-19-16(18-15)17(2,3)4/h14H,5-13H2,1-4H3 |
| InChIKey | RHGFPIZVGANDQG-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-4-decyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-4-decyl-1,3-oxazole?
The IUPAC name of 2-tert-butyl-4-decyl-1,3-oxazole (CID 57051564) is 2-tert-butyl-4-decyl-1,3-oxazole.
What is the SMILES notation for 2-tert-butyl-4-decyl-1,3-oxazole?
The canonical SMILES for 2-tert-butyl-4-decyl-1,3-oxazole is CCCCCCCCCCc1coc(C(C)(C)C)n1.
What is the InChIKey of 2-tert-butyl-4-decyl-1,3-oxazole?
The InChIKey is RHGFPIZVGANDQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31NO/c1-5-6-7-8-9-10-11-12-13-15-14-19-16(18-15)17(2,3)4/h14H,5-13H2,1-4H3.
What are the key properties of 2-tert-butyl-4-decyl-1,3-oxazole?
2-tert-butyl-4-decyl-1,3-oxazole has a molecular weight of 265.44 g/mol, XLogP of 5.66, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-4-decyl-1,3-oxazole is sourced from PubChem (CID 57051564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).