C38H48N2O7S2 — CID 57051773
prop-2-enyl (2R,4S)-2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(methylsulfonyloxymethyl)butyl]-4-tritylsulfanylpyrrolidine-1-carboxylate (PubChem CID 57051773) has the molecular formula C38H48N2O7S2 and a molecular weight of 708.94 g/mol. Its IUPAC name is prop-2-enyl (2R,4S)-2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(methylsulfonyloxymethyl)butyl]-4-tritylsulfanylpyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2R,4S)-2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(methylsulfonyloxymethyl)butyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57051773 |
| Molecular Formula | C38H48N2O7S2 |
| Molecular Weight | 708.94 g/mol |
| Exact Mass | 708.29 |
| IUPAC Name | prop-2-enyl (2R,4S)-2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(methylsulfonyloxymethyl)butyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@@H](SC(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@H]1CC(CCNC(=O)OC(C)(C)C)COS(C)(=O)=O |
| InChI | InChI=1S/C38H48N2O7S2/c1-6-24-45-36(42)40-27-34(26-33(40)25-29(28-46-49(5,43)44)22-23-39-35(41)47-37(2,3)4)48-38(30-16-10-7-11-17-30,31-18-12-8-13-19-31)32-20-14-9-15-21-32/h6-21,29,33-34H,1,22-28H2,2-5H3,(H,39,41)/t29?,33-,34+/m1/s1 |
| InChIKey | ZGHYOWZZXJBKSM-QNFGFYRYSA-N |
| XLogP | 7.37 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.94 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|