About 1-chloro-1-ethoxy-N,N-diethylpropan-2-amine
1-chloro-1-ethoxy-N,N-diethylpropan-2-amine (PubChem CID 57051873) has the molecular formula C9H20ClNO
and a molecular weight of 193.72 g/mol. Its IUPAC name is 1-chloro-1-ethoxy-N,N-diethylpropan-2-amine.
Molecular Properties
| Compound Name | 1-chloro-1-ethoxy-N,N-diethylpropan-2-amine |
| PubChem CID | 57051873 |
| Molecular Formula | C9H20ClNO |
| Molecular Weight | 193.72 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 1-chloro-1-ethoxy-N,N-diethylpropan-2-amine |
| SMILES | CCOC(Cl)C(C)N(CC)CC |
| InChI | InChI=1S/C9H20ClNO/c1-5-11(6-2)8(4)9(10)12-7-3/h8-9H,5-7H2,1-4H3 |
| InChIKey | CUIRAMUNTGSGJN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.72 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-1-ethoxy-N,N-diethylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-1-ethoxy-N,N-diethylpropan-2-amine?
The IUPAC name of 1-chloro-1-ethoxy-N,N-diethylpropan-2-amine (CID 57051873) is 1-chloro-1-ethoxy-N,N-diethylpropan-2-amine.
What is the SMILES notation for 1-chloro-1-ethoxy-N,N-diethylpropan-2-amine?
The canonical SMILES for 1-chloro-1-ethoxy-N,N-diethylpropan-2-amine is CCOC(Cl)C(C)N(CC)CC.
What is the InChIKey of 1-chloro-1-ethoxy-N,N-diethylpropan-2-amine?
The InChIKey is CUIRAMUNTGSGJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20ClNO/c1-5-11(6-2)8(4)9(10)12-7-3/h8-9H,5-7H2,1-4H3.
What are the key properties of 1-chloro-1-ethoxy-N,N-diethylpropan-2-amine?
1-chloro-1-ethoxy-N,N-diethylpropan-2-amine has a molecular weight of 193.72 g/mol, XLogP of 2.32, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-1-ethoxy-N,N-diethylpropan-2-amine is sourced from PubChem (CID 57051873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).