3,5-diamino-4-methylbenzenesulfinic acid

C7H10N2O2S — CID 57051947

IUPAC3,5-diamino-4-methylbenzenesulfinic acid
SMILESCc1c(N)cc(S(=O)O)cc1N
InChIInChI=1S/C7H10N2O2S/c1-4-6(8)2-5(12(10)11)3-7(4)9/h2-3H,8-9H2,1H3,(H,10,11)
InChIKeyPKDWKHCPZGOMJG-UHFFFAOYSA-N
MW186.24 g/mol
LogP0.74
Rot. Bonds1

About 3,5-diamino-4-methylbenzenesulfinic acid

3,5-diamino-4-methylbenzenesulfinic acid (PubChem CID 57051947) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is 3,5-diamino-4-methylbenzenesulfinic acid.

Molecular Properties

Compound Name3,5-diamino-4-methylbenzenesulfinic acid
PubChem CID57051947
Molecular FormulaC7H10N2O2S
Molecular Weight186.24 g/mol
Exact Mass186.05
IUPAC Name3,5-diamino-4-methylbenzenesulfinic acid
SMILESCc1c(N)cc(S(=O)O)cc1N
InChIInChI=1S/C7H10N2O2S/c1-4-6(8)2-5(12(10)11)3-7(4)9/h2-3H,8-9H2,1H3,(H,10,11)
InChIKeyPKDWKHCPZGOMJG-UHFFFAOYSA-N
XLogP0.74
TPSA89.34 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.24
LogP ≤ 50.74
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze 3,5-diamino-4-methylbenzenesulfinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

Benzenesulfonic acid, 3-amino-4-methyl-
CID 69246
5-Amino-2-methylbenzenesulfonic acid
CID 67054
2-amino-N,N-dimethyltoluene-4-sulphonamide
CID 235528
Benzenesulfonic acid, 5-amino-2,4-dimethyl-
CID 80735
3-Amino-4-methylbenzenesulfonamide
CID 235510
3-Amino-4-methylbenzene-1-sulfonyl fluoride
CID 427537
Benzenesulfonic acid, 3,5-diamino-4-methyl-
CID 66812
Benzenesulfonic acid, 4-methyl-3,5-dinitro-
CID 66626
2,6-Diamino-4-methylbenzenesulfonic acid
CID 222229
3-Amino-4-methyl-benzenesulfonic acid
CID 23693801
Benzenesulfonic acid, 2,4-diamino-5-methyl-
CID 66620
Benzenesulfonic acid, 3-amino-4-ethyl-
CID 77278

Frequently Asked Questions

What is the IUPAC name of 3,5-diamino-4-methylbenzenesulfinic acid?
The IUPAC name of 3,5-diamino-4-methylbenzenesulfinic acid (CID 57051947) is 3,5-diamino-4-methylbenzenesulfinic acid.
What is the SMILES notation for 3,5-diamino-4-methylbenzenesulfinic acid?
The canonical SMILES for 3,5-diamino-4-methylbenzenesulfinic acid is Cc1c(N)cc(S(=O)O)cc1N.
What is the InChIKey of 3,5-diamino-4-methylbenzenesulfinic acid?
The InChIKey is PKDWKHCPZGOMJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2S/c1-4-6(8)2-5(12(10)11)3-7(4)9/h2-3H,8-9H2,1H3,(H,10,11).
What are the key properties of 3,5-diamino-4-methylbenzenesulfinic acid?
3,5-diamino-4-methylbenzenesulfinic acid has a molecular weight of 186.24 g/mol, XLogP of 0.74, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diamino-4-methylbenzenesulfinic acid is sourced from PubChem (CID 57051947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).