C25H36O3 — CID 57052594
3-[1-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)cyclopentyl]but-2-enoic acid (PubChem CID 57052594) has the molecular formula C25H36O3 and a molecular weight of 384.56 g/mol. Its IUPAC name is 3-[1-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)cyclopentyl]but-2-enoic acid.
| Compound Name | 3-[1-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)cyclopentyl]but-2-enoic acid |
|---|---|
| PubChem CID | 57052594 |
| Molecular Formula | C25H36O3 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | 3-[1-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)cyclopentyl]but-2-enoic acid |
| SMILES | COC1(C(C)=CC(=O)O)CCC(c2cc3c(cc2C)C(C)(C)CCC3(C)C)C1 |
| InChI | InChI=1S/C25H36O3/c1-16-12-20-21(24(5,6)11-10-23(20,3)4)14-19(16)18-8-9-25(15-18,28-7)17(2)13-22(26)27/h12-14,18H,8-11,15H2,1-7H3,(H,26,27) |
| InChIKey | YKGPKJNSYMLNEQ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|