C37H56O4 — CID 57052760
1,1-bis[2-hydroxy-3,5-bis(2-methylbutan-2-yl)phenyl]ethyl prop-2-enoate (PubChem CID 57052760) has the molecular formula C37H56O4 and a molecular weight of 564.85 g/mol. Its IUPAC name is 1,1-bis[2-hydroxy-3,5-bis(2-methylbutan-2-yl)phenyl]ethyl prop-2-enoate.
| Compound Name | 1,1-bis[2-hydroxy-3,5-bis(2-methylbutan-2-yl)phenyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 57052760 |
| Molecular Formula | C37H56O4 |
| Molecular Weight | 564.85 g/mol |
| Exact Mass | 564.42 |
| IUPAC Name | 1,1-bis[2-hydroxy-3,5-bis(2-methylbutan-2-yl)phenyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)(c1cc(C(C)(C)CC)cc(C(C)(C)CC)c1O)c1cc(C(C)(C)CC)cc(C(C)(C)CC)c1O |
| InChI | InChI=1S/C37H56O4/c1-15-30(38)41-37(14,28-22-24(33(6,7)16-2)20-26(31(28)39)35(10,11)18-4)29-23-25(34(8,9)17-3)21-27(32(29)40)36(12,13)19-5/h15,20-23,39-40H,1,16-19H2,2-14H3 |
| InChIKey | OFIGPSBHZVQYSI-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.85 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|