C14H22O6 — CID 57052987
3-(4,5-dihydroxyhepta-1,6-dien-3-yloxy)hepta-1,6-diene-3,4,5-triol (PubChem CID 57052987) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is 3-(4,5-dihydroxyhepta-1,6-dien-3-yloxy)hepta-1,6-diene-3,4,5-triol.
| Compound Name | 3-(4,5-dihydroxyhepta-1,6-dien-3-yloxy)hepta-1,6-diene-3,4,5-triol |
|---|---|
| PubChem CID | 57052987 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 3-(4,5-dihydroxyhepta-1,6-dien-3-yloxy)hepta-1,6-diene-3,4,5-triol |
| SMILES | C=CC(O)C(O)C(C=C)OC(O)(C=C)C(O)C(O)C=C |
| InChI | InChI=1S/C14H22O6/c1-5-9(15)12(17)11(7-3)20-14(19,8-4)13(18)10(16)6-2/h5-13,15-19H,1-4H2 |
| InChIKey | WJPQKODHPVTAHH-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|