About 2-methylhexadecane-4,7-dione
2-methylhexadecane-4,7-dione (PubChem CID 57053022) has the molecular formula C17H32O2
and a molecular weight of 268.44 g/mol. Its IUPAC name is 2-methylhexadecane-4,7-dione.
Molecular Properties
| Compound Name | 2-methylhexadecane-4,7-dione |
| PubChem CID | 57053022 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | 2-methylhexadecane-4,7-dione |
| SMILES | CCCCCCCCCC(=O)CCC(=O)CC(C)C |
| InChI | InChI=1S/C17H32O2/c1-4-5-6-7-8-9-10-11-16(18)12-13-17(19)14-15(2)3/h15H,4-14H2,1-3H3 |
| InChIKey | VKHLXAICGWGROS-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methylhexadecane-4,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhexadecane-4,7-dione?
The IUPAC name of 2-methylhexadecane-4,7-dione (CID 57053022) is 2-methylhexadecane-4,7-dione.
What is the SMILES notation for 2-methylhexadecane-4,7-dione?
The canonical SMILES for 2-methylhexadecane-4,7-dione is CCCCCCCCCC(=O)CCC(=O)CC(C)C.
What is the InChIKey of 2-methylhexadecane-4,7-dione?
The InChIKey is VKHLXAICGWGROS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32O2/c1-4-5-6-7-8-9-10-11-16(18)12-13-17(19)14-15(2)3/h15H,4-14H2,1-3H3.
What are the key properties of 2-methylhexadecane-4,7-dione?
2-methylhexadecane-4,7-dione has a molecular weight of 268.44 g/mol, XLogP of 5.09, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhexadecane-4,7-dione is sourced from PubChem (CID 57053022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).