C19H20ClF3N2O3 — CID 57053065
5-[5-[3-chloro-4-(4,5-dihydro-1,3-oxazol-2-yl)-2-(trifluoromethyl)phenoxy]pentyl]-3-methyl-1,2-oxazole (PubChem CID 57053065) has the molecular formula C19H20ClF3N2O3 and a molecular weight of 416.83 g/mol. Its IUPAC name is 5-[5-[3-chloro-4-(4,5-dihydro-1,3-oxazol-2-yl)-2-(trifluoromethyl)phenoxy]pentyl]-3-methyl-1,2-oxazole.
| Compound Name | 5-[5-[3-chloro-4-(4,5-dihydro-1,3-oxazol-2-yl)-2-(trifluoromethyl)phenoxy]pentyl]-3-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 57053065 |
| Molecular Formula | C19H20ClF3N2O3 |
| Molecular Weight | 416.83 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 5-[5-[3-chloro-4-(4,5-dihydro-1,3-oxazol-2-yl)-2-(trifluoromethyl)phenoxy]pentyl]-3-methyl-1,2-oxazole |
| SMILES | Cc1cc(CCCCCOc2ccc(C3=NCCO3)c(Cl)c2C(F)(F)F)on1 |
| InChI | InChI=1S/C19H20ClF3N2O3/c1-12-11-13(28-25-12)5-3-2-4-9-26-15-7-6-14(18-24-8-10-27-18)17(20)16(15)19(21,22)23/h6-7,11H,2-5,8-10H2,1H3 |
| InChIKey | NFCNOMIYAKXOEH-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 56.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.83 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|