C22H37BrO4 — CID 57053112
methyl (2R,6R)-6-[(1R,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-(methoxymethoxy)-2-methylheptanoate (PubChem CID 57053112) has the molecular formula C22H37BrO4 and a molecular weight of 445.44 g/mol. Its IUPAC name is methyl (2R,6R)-6-[(1R,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-(methoxymethoxy)-2-methylheptanoate.
| Compound Name | methyl (2R,6R)-6-[(1R,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-(methoxymethoxy)-2-methylheptanoate |
|---|---|
| PubChem CID | 57053112 |
| Molecular Formula | C22H37BrO4 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | methyl (2R,6R)-6-[(1R,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-(methoxymethoxy)-2-methylheptanoate |
| SMILES | COCO[C@](C)(CCC[C@@H](C)[C@H]1CCC2C(=CBr)CCC[C@@]21C)C(=O)OC |
| InChI | InChI=1S/C22H37BrO4/c1-16(8-6-13-22(3,20(24)26-5)27-15-25-4)18-10-11-19-17(14-23)9-7-12-21(18,19)2/h14,16,18-19H,6-13,15H2,1-5H3/t16-,18-,19?,21-,22-/m1/s1 |
| InChIKey | MZQFLOQKBBFHQA-PKKIPDDDSA-N |
| XLogP | 5.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|