C36H56O9SSi — CID 57053137
5-[(1S,2S,3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(oxan-2-yloxy)-2-[1-(oxan-2-yloxy)-4-phenoxybut-1-enyl]cyclopentyl]pent-2-yne-1-sulfonic acid (PubChem CID 57053137) has the molecular formula C36H56O9SSi and a molecular weight of 692.99 g/mol. Its IUPAC name is 5-[(1S,2S,3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(oxan-2-yloxy)-2-[1-(oxan-2-yloxy)-4-phenoxybut-1-enyl]cyclopentyl]pent-2-yne-1-sulfonic acid.
| Compound Name | 5-[(1S,2S,3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(oxan-2-yloxy)-2-[1-(oxan-2-yloxy)-4-phenoxybut-1-enyl]cyclopentyl]pent-2-yne-1-sulfonic acid |
|---|---|
| PubChem CID | 57053137 |
| Molecular Formula | C36H56O9SSi |
| Molecular Weight | 692.99 g/mol |
| Exact Mass | 692.34 |
| IUPAC Name | 5-[(1S,2S,3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(oxan-2-yloxy)-2-[1-(oxan-2-yloxy)-4-phenoxybut-1-enyl]cyclopentyl]pent-2-yne-1-sulfonic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@H](OC2CCCCO2)[C@@H](C(=CCCOc2ccccc2)OC2CCCCO2)[C@@H]1CCC#CCS(=O)(=O)O |
| InChI | InChI=1S/C36H56O9SSi/c1-36(2,3)47(4,5)45-31-27-32(44-34-22-12-14-24-42-34)35(29(31)19-10-7-15-26-46(37,38)39)30(43-33-21-11-13-23-41-33)20-16-25-40-28-17-8-6-9-18-28/h6,8-9,17-18,20,29,31-35H,10-14,16,19,21-27H2,1-5H3,(H,37,38,39)/t29-,31-,32+,33?,34?,35-/m1/s1 |
| InChIKey | CRGQBZRRBZZUSX-GZSDTONKSA-N |
| XLogP | 7.49 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.99 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|