About (2S)-N'-acetyl-1-(4-fluorophenyl)sulfonylpiperidine-2-carbohydrazide
(2S)-N'-acetyl-1-(4-fluorophenyl)sulfonylpiperidine-2-carbohydrazide (PubChem CID 57053283) has the molecular formula C14H18FN3O4S
and a molecular weight of 343.38 g/mol. Its IUPAC name is (2S)-N'-acetyl-1-(4-fluorophenyl)sulfonylpiperidine-2-carbohydrazide.
Molecular Properties
| Compound Name | (2S)-N'-acetyl-1-(4-fluorophenyl)sulfonylpiperidine-2-carbohydrazide |
| PubChem CID | 57053283 |
| Molecular Formula | C14H18FN3O4S |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | (2S)-N'-acetyl-1-(4-fluorophenyl)sulfonylpiperidine-2-carbohydrazide |
| SMILES | CC(=O)NNC(=O)[C@@H]1CCCCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H18FN3O4S/c1-10(19)16-17-14(20)13-4-2-3-9-18(13)23(21,22)12-7-5-11(15)6-8-12/h5-8,13H,2-4,9H2,1H3,(H,16,19)(H,17,20)/t13-/m0/s1 |
| InChIKey | CZDODYSFKQCLDM-ZDUSSCGKSA-N |
| XLogP | 0.54 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-N'-acetyl-1-(4-fluorophenyl)sulfonylpiperidine-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N'-acetyl-1-(4-fluorophenyl)sulfonylpiperidine-2-carbohydrazide?
The IUPAC name of (2S)-N'-acetyl-1-(4-fluorophenyl)sulfonylpiperidine-2-carbohydrazide (CID 57053283) is (2S)-N'-acetyl-1-(4-fluorophenyl)sulfonylpiperidine-2-carbohydrazide.
What is the SMILES notation for (2S)-N'-acetyl-1-(4-fluorophenyl)sulfonylpiperidine-2-carbohydrazide?
The canonical SMILES for (2S)-N'-acetyl-1-(4-fluorophenyl)sulfonylpiperidine-2-carbohydrazide is CC(=O)NNC(=O)[C@@H]1CCCCN1S(=O)(=O)c1ccc(F)cc1.
What is the InChIKey of (2S)-N'-acetyl-1-(4-fluorophenyl)sulfonylpiperidine-2-carbohydrazide?
The InChIKey is CZDODYSFKQCLDM-ZDUSSCGKSA-N. The full InChI is InChI=1S/C14H18FN3O4S/c1-10(19)16-17-14(20)13-4-2-3-9-18(13)23(21,22)12-7-5-11(15)6-8-12/h5-8,13H,2-4,9H2,1H3,(H,16,19)(H,17,20)/t13-/m0/s1.
What are the key properties of (2S)-N'-acetyl-1-(4-fluorophenyl)sulfonylpiperidine-2-carbohydrazide?
(2S)-N'-acetyl-1-(4-fluorophenyl)sulfonylpiperidine-2-carbohydrazide has a molecular weight of 343.38 g/mol, XLogP of 0.54, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N'-acetyl-1-(4-fluorophenyl)sulfonylpiperidine-2-carbohydrazide is sourced from PubChem (CID 57053283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).