C20H19N9O5S3 — CID 57053352
(6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(7-methyl-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 57053352) has the molecular formula C20H19N9O5S3 and a molecular weight of 561.63 g/mol. Its IUPAC name is (6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(7-methyl-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(7-methyl-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 57053352 |
| Molecular Formula | C20H19N9O5S3 |
| Molecular Weight | 561.63 g/mol |
| Exact Mass | 561.07 |
| IUPAC Name | (6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(7-methyl-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CON=C(C(=O)N[C@@H]1C(=O)N2C(C(=O)O)=C(CSc3nc(C)cc4ncnn34)CS[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C20H19N9O5S3/c1-8-3-11-22-7-23-29(11)20(24-8)37-5-9-4-35-17-13(16(31)28(17)14(9)18(32)33)26-15(30)12(27-34-2)10-6-36-19(21)25-10/h3,6-7,13,17H,4-5H2,1-2H3,(H2,21,25)(H,26,30)(H,32,33)/t13-,17-/m1/s1 |
| InChIKey | AHPYLNJCTRPITM-CXAGYDPISA-N |
| XLogP | 0.35 |
| TPSA | 190.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.63 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|