About (2R)-1-(3,3-diethyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid
(2R)-1-(3,3-diethyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57053590) has the molecular formula C16H28NO3S+
and a molecular weight of 314.47 g/mol. Its IUPAC name is (2R)-1-(3,3-diethyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid.
Molecular Properties
| Compound Name | (2R)-1-(3,3-diethyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| PubChem CID | 57053590 |
| Molecular Formula | C16H28NO3S+ |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | (2R)-1-(3,3-diethyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CCC1(CC)CCC(C(=O)[N+]2(C(=O)O)CCC[C@H]2C)C1S |
| InChI | InChI=1S/C16H27NO3S/c1-4-16(5-2)9-8-12(13(16)21)14(18)17(15(19)20)10-6-7-11(17)3/h11-13H,4-10H2,1-3H3,(H-,19,20,21)/p+1/t11-,12?,13?,17?/m1/s1 |
| InChIKey | JKCOVDCDAZARKW-PJMHRPOASA-O |
| XLogP | 3.70 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1-(3,3-diethyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-(3,3-diethyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid?
The IUPAC name of (2R)-1-(3,3-diethyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid (CID 57053590) is (2R)-1-(3,3-diethyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid.
What is the SMILES notation for (2R)-1-(3,3-diethyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid?
The canonical SMILES for (2R)-1-(3,3-diethyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid is CCC1(CC)CCC(C(=O)[N+]2(C(=O)O)CCC[C@H]2C)C1S.
What is the InChIKey of (2R)-1-(3,3-diethyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid?
The InChIKey is JKCOVDCDAZARKW-PJMHRPOASA-O. The full InChI is InChI=1S/C16H27NO3S/c1-4-16(5-2)9-8-12(13(16)21)14(18)17(15(19)20)10-6-7-11(17)3/h11-13H,4-10H2,1-3H3,(H-,19,20,21)/p+1/t11-,12?,13?,17?/m1/s1.
What are the key properties of (2R)-1-(3,3-diethyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid?
(2R)-1-(3,3-diethyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid has a molecular weight of 314.47 g/mol, XLogP of 3.70, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-(3,3-diethyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid is sourced from PubChem (CID 57053590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).