3-(4-hydroxy-3,5-diiodoanilino)propane-1-sulfonic acid

C9H11I2NO4S — CID 57053722

IUPAC3-(4-hydroxy-3,5-diiodoanilino)propane-1-sulfonic acid
SMILESO=S(=O)(O)CCCNc1cc(I)c(O)c(I)c1
InChIInChI=1S/C9H11I2NO4S/c10-7-4-6(5-8(11)9(7)13)12-2-1-3-17(14,15)16/h4-5,12-13H,1-3H2,(H,14,15,16)
InChIKeyFNZOMQLKOFBDMC-UHFFFAOYSA-N
MW483.07 g/mol
LogP2.29
Rot. Bonds5

About 3-(4-hydroxy-3,5-diiodoanilino)propane-1-sulfonic acid

3-(4-hydroxy-3,5-diiodoanilino)propane-1-sulfonic acid (PubChem CID 57053722) has the molecular formula C9H11I2NO4S and a molecular weight of 483.07 g/mol. Its IUPAC name is 3-(4-hydroxy-3,5-diiodoanilino)propane-1-sulfonic acid.

Molecular Properties

Compound Name3-(4-hydroxy-3,5-diiodoanilino)propane-1-sulfonic acid
PubChem CID57053722
Molecular FormulaC9H11I2NO4S
Molecular Weight483.07 g/mol
Exact Mass482.85
IUPAC Name3-(4-hydroxy-3,5-diiodoanilino)propane-1-sulfonic acid
SMILESO=S(=O)(O)CCCNc1cc(I)c(O)c(I)c1
InChIInChI=1S/C9H11I2NO4S/c10-7-4-6(5-8(11)9(7)13)12-2-1-3-17(14,15)16/h4-5,12-13H,1-3H2,(H,14,15,16)
InChIKeyFNZOMQLKOFBDMC-UHFFFAOYSA-N
XLogP2.29
TPSA86.63 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500483.07
LogP ≤ 52.29
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 3-(4-hydroxy-3,5-diiodoanilino)propane-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-hydroxy-3,5-diiodoanilino)propane-1-sulfonic acid?
The IUPAC name of 3-(4-hydroxy-3,5-diiodoanilino)propane-1-sulfonic acid (CID 57053722) is 3-(4-hydroxy-3,5-diiodoanilino)propane-1-sulfonic acid.
What is the SMILES notation for 3-(4-hydroxy-3,5-diiodoanilino)propane-1-sulfonic acid?
The canonical SMILES for 3-(4-hydroxy-3,5-diiodoanilino)propane-1-sulfonic acid is O=S(=O)(O)CCCNc1cc(I)c(O)c(I)c1.
What is the InChIKey of 3-(4-hydroxy-3,5-diiodoanilino)propane-1-sulfonic acid?
The InChIKey is FNZOMQLKOFBDMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11I2NO4S/c10-7-4-6(5-8(11)9(7)13)12-2-1-3-17(14,15)16/h4-5,12-13H,1-3H2,(H,14,15,16).
What are the key properties of 3-(4-hydroxy-3,5-diiodoanilino)propane-1-sulfonic acid?
3-(4-hydroxy-3,5-diiodoanilino)propane-1-sulfonic acid has a molecular weight of 483.07 g/mol, XLogP of 2.29, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-hydroxy-3,5-diiodoanilino)propane-1-sulfonic acid is sourced from PubChem (CID 57053722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).