C23H22F3NO3 — CID 57053907
ethyl 2-[3-[1-(1H-pyrrol-2-yl)-2-[3-(trifluoromethoxy)phenyl]ethyl]phenyl]acetate (PubChem CID 57053907) has the molecular formula C23H22F3NO3 and a molecular weight of 417.43 g/mol. Its IUPAC name is ethyl 2-[3-[1-(1H-pyrrol-2-yl)-2-[3-(trifluoromethoxy)phenyl]ethyl]phenyl]acetate.
| Compound Name | ethyl 2-[3-[1-(1H-pyrrol-2-yl)-2-[3-(trifluoromethoxy)phenyl]ethyl]phenyl]acetate |
|---|---|
| PubChem CID | 57053907 |
| Molecular Formula | C23H22F3NO3 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | ethyl 2-[3-[1-(1H-pyrrol-2-yl)-2-[3-(trifluoromethoxy)phenyl]ethyl]phenyl]acetate |
| SMILES | CCOC(=O)Cc1cccc(C(Cc2cccc(OC(F)(F)F)c2)c2ccc[nH]2)c1 |
| InChI | InChI=1S/C23H22F3NO3/c1-2-29-22(28)15-16-6-3-8-18(12-16)20(21-10-5-11-27-21)14-17-7-4-9-19(13-17)30-23(24,25)26/h3-13,20,27H,2,14-15H2,1H3 |
| InChIKey | MCFCPAJXNNRYGW-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |